C23H19F4N3O5 — CID 166074515
3-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[4-fluoro-3-(trifluoromethoxy)phenyl]propanamide (PubChem CID 166074515) has the molecular formula C23H19F4N3O5 and a molecular weight of 493.41 g/mol. Its IUPAC name is 3-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[4-fluoro-3-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 3-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[4-fluoro-3-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 166074515 |
| Molecular Formula | C23H19F4N3O5 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 3-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-[4-fluoro-3-(trifluoromethoxy)phenyl]propanamide |
| SMILES | O=C1CCC(N2Cc3ccc(CCC(=O)Nc4ccc(F)c(OC(F)(F)F)c4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H19F4N3O5/c24-16-5-4-14(10-18(16)35-23(25,26)27)28-19(31)7-2-12-1-3-13-11-30(22(34)15(13)9-12)17-6-8-20(32)29-21(17)33/h1,3-5,9-10,17H,2,6-8,11H2,(H,28,31)(H,29,32,33) |
| InChIKey | IUVOWMONZKZJDF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|