C25H26FN3O6 — CID 164584017
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-fluoro-5-[(2-methylpropan-2-yl)oxy]phenyl]carbamate (PubChem CID 164584017) has the molecular formula C25H26FN3O6 and a molecular weight of 483.50 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-fluoro-5-[(2-methylpropan-2-yl)oxy]phenyl]carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-fluoro-5-[(2-methylpropan-2-yl)oxy]phenyl]carbamate |
|---|---|
| PubChem CID | 164584017 |
| Molecular Formula | C25H26FN3O6 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-fluoro-5-[(2-methylpropan-2-yl)oxy]phenyl]carbamate |
| SMILES | CC(C)(C)Oc1ccc(F)c(NC(=O)OCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)c1 |
| InChI | InChI=1S/C25H26FN3O6/c1-25(2,3)35-16-6-7-18(26)19(11-16)27-24(33)34-13-14-4-5-15-12-29(23(32)17(15)10-14)20-8-9-21(30)28-22(20)31/h4-7,10-11,20H,8-9,12-13H2,1-3H3,(H,27,33)(H,28,30,31) |
| InChIKey | MQFRYBKONCKERQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|