C23H21F2N3O6 — CID 177223362
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[3-(difluoromethoxy)-5-methylphenyl]carbamate (PubChem CID 177223362) has the molecular formula C23H21F2N3O6 and a molecular weight of 473.43 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[3-(difluoromethoxy)-5-methylphenyl]carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[3-(difluoromethoxy)-5-methylphenyl]carbamate |
|---|---|
| PubChem CID | 177223362 |
| Molecular Formula | C23H21F2N3O6 |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[3-(difluoromethoxy)-5-methylphenyl]carbamate |
| SMILES | Cc1cc(NC(=O)OCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)cc(OC(F)F)c1 |
| InChI | InChI=1S/C23H21F2N3O6/c1-12-6-15(9-16(7-12)34-22(24)25)26-23(32)33-11-13-2-3-14-10-28(21(31)17(14)8-13)18-4-5-19(29)27-20(18)30/h2-3,6-9,18,22H,4-5,10-11H2,1H3,(H,26,32)(H,27,29,30) |
| InChIKey | ZZDHKFJLZUXBBD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|