C15H14I2N3O5- — CID 166074298
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-iodoiodanuidylcarbamate (PubChem CID 166074298) has the molecular formula C15H14I2N3O5- and a molecular weight of 570.10 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-iodoiodanuidylcarbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-iodoiodanuidylcarbamate |
|---|---|
| PubChem CID | 166074298 |
| Molecular Formula | C15H14I2N3O5- |
| Molecular Weight | 570.10 g/mol |
| Exact Mass | 569.90 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-iodoiodanuidylcarbamate |
| SMILES | O=C1CCC(N2Cc3ccc(COC(=O)N[I-]I)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H14I2N3O5/c16-17-19-15(24)25-7-8-1-2-9-6-20(14(23)10(9)5-8)11-3-4-12(21)18-13(11)22/h1-2,5,11H,3-4,6-7H2,(H,19,24)(H,18,21,22)/q-1 |
| InChIKey | WRGUPMSKHUCYQM-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.10 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|