C20H18N4O5 — CID 166074247
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-pyridin-3-ylcarbamate (PubChem CID 166074247) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-pyridin-3-ylcarbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-pyridin-3-ylcarbamate |
|---|---|
| PubChem CID | 166074247 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-pyridin-3-ylcarbamate |
| SMILES | O=C1CCC(N2Cc3ccc(COC(=O)Nc4cccnc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H18N4O5/c25-17-6-5-16(18(26)23-17)24-10-13-4-3-12(8-15(13)19(24)27)11-29-20(28)22-14-2-1-7-21-9-14/h1-4,7-9,16H,5-6,10-11H2,(H,22,28)(H,23,25,26) |
| InChIKey | JUEXCHQRHNAIAY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|