C24H21F2N3O6 — CID 164583893
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[3-(2,2-difluorocyclopropyl)oxyphenyl]carbamate (PubChem CID 164583893) has the molecular formula C24H21F2N3O6 and a molecular weight of 485.44 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[3-(2,2-difluorocyclopropyl)oxyphenyl]carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[3-(2,2-difluorocyclopropyl)oxyphenyl]carbamate |
|---|---|
| PubChem CID | 164583893 |
| Molecular Formula | C24H21F2N3O6 |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[3-(2,2-difluorocyclopropyl)oxyphenyl]carbamate |
| SMILES | O=C1CCC(N2Cc3ccc(COC(=O)Nc4cccc(OC5CC5(F)F)c4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H21F2N3O6/c25-24(26)10-19(24)35-16-3-1-2-15(9-16)27-23(33)34-12-13-4-5-14-11-29(22(32)17(14)8-13)18-6-7-20(30)28-21(18)31/h1-5,8-9,18-19H,6-7,10-12H2,(H,27,33)(H,28,30,31) |
| InChIKey | IWSFCGVHLTWHDV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|