C25H25F2N3O6 — CID 177223388
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-(2,2-difluoro-3H-1-benzofuran-5-yl)carbamate;ethane (PubChem CID 177223388) has the molecular formula C25H25F2N3O6 and a molecular weight of 501.49 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-(2,2-difluoro-3H-1-benzofuran-5-yl)carbamate;ethane.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-(2,2-difluoro-3H-1-benzofuran-5-yl)carbamate;ethane |
|---|---|
| PubChem CID | 177223388 |
| Molecular Formula | C25H25F2N3O6 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-(2,2-difluoro-3H-1-benzofuran-5-yl)carbamate;ethane |
| SMILES | CC.O=C1CCC(N2Cc3ccc(COC(=O)Nc4ccc5c(c4)CC(F)(F)O5)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H19F2N3O6.C2H6/c24-23(25)9-14-8-15(3-5-18(14)34-23)26-22(32)33-11-12-1-2-13-10-28(21(31)16(13)7-12)17-4-6-19(29)27-20(17)30;1-2/h1-3,5,7-8,17H,4,6,9-11H2,(H,26,32)(H,27,29,30);1-2H3 |
| InChIKey | AUZKWOORTAKRHF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|