C20H26N4O5 — CID 164584062
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-(methylamino)prop-2-enyl]carbamate;methane (PubChem CID 164584062) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-(methylamino)prop-2-enyl]carbamate;methane.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-(methylamino)prop-2-enyl]carbamate;methane |
|---|---|
| PubChem CID | 164584062 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-(methylamino)prop-2-enyl]carbamate;methane |
| SMILES | C.C=C(CNC(=O)OCc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2)NC |
| InChI | InChI=1S/C19H22N4O5.CH4/c1-11(20-2)8-21-19(27)28-10-12-3-4-13-9-23(18(26)14(13)7-12)15-5-6-16(24)22-17(15)25;/h3-4,7,15,20H,1,5-6,8-10H2,2H3,(H,21,27)(H,22,24,25);1H4 |
| InChIKey | OHAFDAMEKZNFCQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|