C21H17N5O3 — CID 155822533
3-[3-oxo-5-(quinazolin-4-ylamino)-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 155822533) has the molecular formula C21H17N5O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is 3-[3-oxo-5-(quinazolin-4-ylamino)-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-5-(quinazolin-4-ylamino)-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155822533 |
| Molecular Formula | C21H17N5O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-[3-oxo-5-(quinazolin-4-ylamino)-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(Nc4ncnc5ccccc45)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H17N5O3/c27-18-8-7-17(20(28)25-18)26-10-12-5-6-13(9-15(12)21(26)29)24-19-14-3-1-2-4-16(14)22-11-23-19/h1-6,9,11,17H,7-8,10H2,(H,22,23,24)(H,25,27,28) |
| InChIKey | RLJZIAOTDFDGPG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|