C30H35N7O8 — CID 156528267
N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-6-(quinazolin-4-ylamino)-3H-isoindol-4-yl]oxy]acetamide (PubChem CID 156528267) has the molecular formula C30H35N7O8 and a molecular weight of 621.65 g/mol. Its IUPAC name is N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-6-(quinazolin-4-ylamino)-3H-isoindol-4-yl]oxy]acetamide.
| Compound Name | N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-6-(quinazolin-4-ylamino)-3H-isoindol-4-yl]oxy]acetamide |
|---|---|
| PubChem CID | 156528267 |
| Molecular Formula | C30H35N7O8 |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | N-[2-[2-[2-(aminomethoxy)ethoxy]ethoxy]ethyl]-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-6-(quinazolin-4-ylamino)-3H-isoindol-4-yl]oxy]acetamide |
| SMILES | NCOCCOCCOCCNC(=O)COc1cc(Nc2ncnc3ccccc23)cc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C30H35N7O8/c31-17-44-12-11-43-10-9-42-8-7-32-27(39)16-45-25-14-19(35-28-20-3-1-2-4-23(20)33-18-34-28)13-21-22(25)15-37(30(21)41)24-5-6-26(38)36-29(24)40/h1-4,13-14,18,24H,5-12,15-17,31H2,(H,32,39)(H,33,34,35)(H,36,38,40) |
| InChIKey | VAVOLCUHDRWBOX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 196.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|