C25H26N4O8 — CID 162704230
N-[2-[2-(4-aminophenoxy)ethoxy]ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide (PubChem CID 162704230) has the molecular formula C25H26N4O8 and a molecular weight of 510.50 g/mol. Its IUPAC name is N-[2-[2-(4-aminophenoxy)ethoxy]ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide.
| Compound Name | N-[2-[2-(4-aminophenoxy)ethoxy]ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide |
|---|---|
| PubChem CID | 162704230 |
| Molecular Formula | C25H26N4O8 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | N-[2-[2-(4-aminophenoxy)ethoxy]ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide |
| SMILES | Nc1ccc(OCCOCCNC(=O)COc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C25H26N4O8/c26-15-4-6-16(7-5-15)36-13-12-35-11-10-27-21(31)14-37-19-3-1-2-17-22(19)25(34)29(24(17)33)18-8-9-20(30)28-23(18)32/h1-7,18H,8-14,26H2,(H,27,31)(H,28,30,32) |
| InChIKey | YDOWSCLLUJQHRZ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 166.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|