C25H32N4O10 — CID 170060386
N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide (PubChem CID 170060386) has the molecular formula C25H32N4O10 and a molecular weight of 548.55 g/mol. Its IUPAC name is N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide.
| Compound Name | N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide |
|---|---|
| PubChem CID | 170060386 |
| Molecular Formula | C25H32N4O10 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide |
| SMILES | CC(=O)NCCOCCOCCOCCNC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H32N4O10/c1-16(30)26-7-9-36-11-13-38-14-12-37-10-8-27-21(32)15-39-19-4-2-3-17-22(19)25(35)29(24(17)34)18-5-6-20(31)28-23(18)33/h2-4,18H,5-15H2,1H3,(H,26,30)(H,27,32)(H,28,31,33) |
| InChIKey | SYNZAZCPSIJCDA-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 178.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|