C21H26N4O7 — CID 154003382
N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 154003382) has the molecular formula C21H26N4O7 and a molecular weight of 446.46 g/mol. Its IUPAC name is N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 154003382 |
| Molecular Formula | C21H26N4O7 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H26N4O7/c1-13(26)22-7-9-31-11-12-32-10-8-23-15-4-2-3-14-18(15)21(30)25(20(14)29)16-5-6-17(27)24-19(16)28/h2-4,16,23H,5-12H2,1H3,(H,22,26)(H,24,27,28) |
| InChIKey | OJHJUWCHWFDHMD-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|