C23H30N4O8 — CID 166772051
3-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxy]propoxy]propylcarbamic acid (PubChem CID 166772051) has the molecular formula C23H30N4O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is 3-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxy]propoxy]propylcarbamic acid.
| Compound Name | 3-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxy]propoxy]propylcarbamic acid |
|---|---|
| PubChem CID | 166772051 |
| Molecular Formula | C23H30N4O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 3-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxy]propoxy]propylcarbamic acid |
| SMILES | O=C(O)NCCCOCCCOCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H30N4O8/c28-18-8-7-17(20(29)26-18)27-21(30)15-5-1-6-16(19(15)22(27)31)24-9-2-11-34-13-4-14-35-12-3-10-25-23(32)33/h1,5-6,17,24-25H,2-4,7-14H2,(H,32,33)(H,26,28,29) |
| InChIKey | WYESQEHUSVWYBL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|