C20H23N3O9 — CID 170175173
2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl hydrogen carbonate (PubChem CID 170175173) has the molecular formula C20H23N3O9 and a molecular weight of 449.42 g/mol. Its IUPAC name is 2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl hydrogen carbonate.
| Compound Name | 2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl hydrogen carbonate |
|---|---|
| PubChem CID | 170175173 |
| Molecular Formula | C20H23N3O9 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl hydrogen carbonate |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCOCCOCCOC(=O)O)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H23N3O9/c24-15-5-4-14(17(25)22-15)23-18(26)12-2-1-3-13(16(12)19(23)27)21-6-7-30-8-9-31-10-11-32-20(28)29/h1-3,14,21H,4-11H2,(H,28,29)(H,22,24,25) |
| InChIKey | PGCCDHDRUCMBIZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|