C26H36N4O11 — CID 166772095
2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 166772095) has the molecular formula C26H36N4O11 and a molecular weight of 580.59 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 166772095 |
| Molecular Formula | C26H36N4O11 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOCCOCCOCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H36N4O11/c31-21-5-4-20(23(32)29-21)30-24(33)18-2-1-3-19(22(18)25(30)34)27-6-8-37-10-12-39-14-16-41-17-15-40-13-11-38-9-7-28-26(35)36/h1-3,20,27-28H,4-17H2,(H,35,36)(H,29,31,32) |
| InChIKey | GYNOYSHFLAQYEN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 191.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|