C25H34N4O9 — CID 166807997
3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-methylpropanamide (PubChem CID 166807997) has the molecular formula C25H34N4O9 and a molecular weight of 534.57 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-methylpropanamide.
| Compound Name | 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-methylpropanamide |
|---|---|
| PubChem CID | 166807997 |
| Molecular Formula | C25H34N4O9 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-methylpropanamide |
| SMILES | CNC(=O)CCOCCOCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H34N4O9/c1-26-20(30)7-9-35-11-13-37-15-16-38-14-12-36-10-8-27-18-4-2-3-17-22(18)25(34)29(24(17)33)19-5-6-21(31)28-23(19)32/h2-4,19,27H,5-16H2,1H3,(H,26,30)(H,28,31,32) |
| InChIKey | MOHALWYESZEPSH-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|