C31H44N4O9 — CID 139483315
3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[(Z)-hept-4-en-2-yl]propanamide (PubChem CID 139483315) has the molecular formula C31H44N4O9 and a molecular weight of 616.71 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[(Z)-hept-4-en-2-yl]propanamide.
| Compound Name | 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[(Z)-hept-4-en-2-yl]propanamide |
|---|---|
| PubChem CID | 139483315 |
| Molecular Formula | C31H44N4O9 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[(Z)-hept-4-en-2-yl]propanamide |
| SMILES | CC/C=C\CC(C)NC(=O)CCOCCOCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C31H44N4O9/c1-3-4-5-7-22(2)33-27(37)12-14-41-16-18-43-20-21-44-19-17-42-15-13-32-24-9-6-8-23-28(24)31(40)35(30(23)39)25-10-11-26(36)34-29(25)38/h4-6,8-9,22,25,32H,3,7,10-21H2,1-2H3,(H,33,37)(H,34,36,38)/b5-4- |
| InChIKey | UGAXCPBHXAEXLV-PLNGDYQASA-N |
| XLogP | 1.82 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|