C26H36N4O10 — CID 155020195
N-[2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]formamide (PubChem CID 155020195) has the molecular formula C26H36N4O10 and a molecular weight of 564.59 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]formamide.
| Compound Name | N-[2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]formamide |
|---|---|
| PubChem CID | 155020195 |
| Molecular Formula | C26H36N4O10 |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | N-[2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]formamide |
| SMILES | O=CNCCOCCOCCOCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H36N4O10/c31-18-27-6-8-36-10-12-38-14-16-40-17-15-39-13-11-37-9-7-28-20-3-1-2-19-23(20)26(35)30(25(19)34)21-4-5-22(32)29-24(21)33/h1-3,18,21,28H,4-17H2,(H,27,31)(H,29,32,33) |
| InChIKey | RTCLZIMITYYCQL-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 170.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|