C28H41ClN4O9 — CID 155292597
2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-(2-piperidin-4-yloxyethoxy)ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione;hydrochloride (PubChem CID 155292597) has the molecular formula C28H41ClN4O9 and a molecular weight of 613.11 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-(2-piperidin-4-yloxyethoxy)ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-(2-piperidin-4-yloxyethoxy)ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 155292597 |
| Molecular Formula | C28H41ClN4O9 |
| Molecular Weight | 613.11 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-(2-piperidin-4-yloxyethoxy)ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(N2C(=O)c3cccc(NCCOCCOCCOCCOCCOC4CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H40N4O9.ClH/c33-24-5-4-23(26(34)31-24)32-27(35)21-2-1-3-22(25(21)28(32)36)30-10-11-37-12-13-38-14-15-39-16-17-40-18-19-41-20-6-8-29-9-7-20;/h1-3,20,23,29-30H,4-19H2,(H,31,33,34);1H |
| InChIKey | JGAAPLORFQWTPU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 153.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.11 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|