C22H28N4O9 — CID 146309802
2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 146309802) has the molecular formula C22H28N4O9 and a molecular weight of 492.49 g/mol. Its IUPAC name is 2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 146309802 |
| Molecular Formula | C22H28N4O9 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H28N4O9/c27-17-5-4-16(19(28)25-17)26-20(29)14-2-1-3-15(18(14)21(26)30)23-6-8-33-10-12-35-13-11-34-9-7-24-22(31)32/h1-3,16,23-24H,4-13H2,(H,31,32)(H,25,27,28) |
| InChIKey | VNXBFPCZMCMKCO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 172.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|