C24H32N4O8 — CID 163291766
2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-[2-(methylideneamino)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione (PubChem CID 163291766) has the molecular formula C24H32N4O8 and a molecular weight of 504.54 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-[2-(methylideneamino)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-[2-(methylideneamino)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163291766 |
| Molecular Formula | C24H32N4O8 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-[2-(methylideneamino)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione |
| SMILES | C=NCCOCCOCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H32N4O8/c1-25-7-9-33-11-13-35-15-16-36-14-12-34-10-8-26-18-4-2-3-17-21(18)24(32)28(23(17)31)19-5-6-20(29)27-22(19)30/h2-4,19,26H,1,5-16H2,(H,27,29,30) |
| InChIKey | PAUGCOXHWCLEBZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|