C24H31N3O8 — CID 175817976
butyl 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]propanoate (PubChem CID 175817976) has the molecular formula C24H31N3O8 and a molecular weight of 489.53 g/mol. Its IUPAC name is butyl 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]propanoate.
| Compound Name | butyl 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 175817976 |
| Molecular Formula | C24H31N3O8 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | butyl 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]propanoate |
| SMILES | CCCCOC(=O)CCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H31N3O8/c1-2-3-11-35-20(29)9-12-33-14-15-34-13-10-25-17-6-4-5-16-21(17)24(32)27(23(16)31)18-7-8-19(28)26-22(18)30/h4-6,18,25H,2-3,7-15H2,1H3,(H,26,28,30) |
| InChIKey | OLIDAKROIRRPKZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|