C32H47N5O9 — CID 156735785
tert-butyl 3-[2-[4-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]piperazin-1-yl]ethoxy]propanoate (PubChem CID 156735785) has the molecular formula C32H47N5O9 and a molecular weight of 645.75 g/mol. Its IUPAC name is tert-butyl 3-[2-[4-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]piperazin-1-yl]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[4-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]piperazin-1-yl]ethoxy]propanoate |
|---|---|
| PubChem CID | 156735785 |
| Molecular Formula | C32H47N5O9 |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | tert-butyl 3-[2-[4-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]piperazin-1-yl]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCN1CCN(CCOCCOCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C32H47N5O9/c1-32(2,3)46-27(39)9-17-43-19-15-35-11-13-36(14-12-35)16-20-45-22-21-44-18-10-33-24-6-4-5-23-28(24)31(42)37(30(23)41)25-7-8-26(38)34-29(25)40/h4-6,25,33H,7-22H2,1-3H3,(H,34,38,40) |
| InChIKey | NMKRTHBUBGWDNT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 156.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|