C22H27N3O6 — CID 146410711
tert-butyl 5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoate (PubChem CID 146410711) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is tert-butyl 5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoate.
| Compound Name | tert-butyl 5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoate |
|---|---|
| PubChem CID | 146410711 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | tert-butyl 5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H27N3O6/c1-22(2,3)31-17(27)9-4-5-12-23-14-8-6-7-13-18(14)21(30)25(20(13)29)15-10-11-16(26)24-19(15)28/h6-8,15,23H,4-5,9-12H2,1-3H3,(H,24,26,28) |
| InChIKey | YBBQMYXCPMVHOT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|