C23H24N4O8 — CID 175547456
(2,5-dioxopyrrolidin-1-yl) 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoate (PubChem CID 175547456) has the molecular formula C23H24N4O8 and a molecular weight of 484.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoate |
|---|---|
| PubChem CID | 175547456 |
| Molecular Formula | C23H24N4O8 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoate |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCCC(=O)ON4C(=O)CCC4=O)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H24N4O8/c28-16-9-8-15(21(32)25-16)26-22(33)13-5-4-6-14(20(13)23(26)34)24-12-3-1-2-7-19(31)35-27-17(29)10-11-18(27)30/h4-6,15,24H,1-3,7-12H2,(H,25,28,32) |
| InChIKey | UFFNQAVHXLLPHL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|