C21H24N4O7 — CID 154675498
6-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]hexanoic acid (PubChem CID 154675498) has the molecular formula C21H24N4O7 and a molecular weight of 444.44 g/mol. Its IUPAC name is 6-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 154675498 |
| Molecular Formula | C21H24N4O7 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 6-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H24N4O7/c26-15-9-8-14(19(30)24-15)25-20(31)12-5-4-6-13(18(12)21(25)32)23-11-16(27)22-10-3-1-2-7-17(28)29/h4-6,14,23H,1-3,7-11H2,(H,22,27)(H,28,29)(H,24,26,30) |
| InChIKey | PMWDVRWHEKVYEJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|