C29H41N5O7 — CID 163320884
tert-butyl N-[6-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]hexyl]carbamate (PubChem CID 163320884) has the molecular formula C29H41N5O7 and a molecular weight of 571.68 g/mol. Its IUPAC name is tert-butyl N-[6-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 163320884 |
| Molecular Formula | C29H41N5O7 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | tert-butyl N-[6-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNC(=O)CCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C29H41N5O7/c1-29(2,3)41-28(40)32-18-8-5-4-7-17-31-22(35)13-6-9-16-30-20-12-10-11-19-24(20)27(39)34(26(19)38)21-14-15-23(36)33-25(21)37/h10-12,21,30H,4-9,13-18H2,1-3H3,(H,31,35)(H,32,40)(H,33,36,37) |
| InChIKey | WMSWBTOAKURAMQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|