C24H30N4O8 — CID 131999803
tert-butyl N-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butyl]carbamate (PubChem CID 131999803) has the molecular formula C24H30N4O8 and a molecular weight of 502.52 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 131999803 |
| Molecular Formula | C24H30N4O8 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | tert-butyl N-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H30N4O8/c1-24(2,3)36-23(34)26-12-5-4-11-25-18(30)13-35-16-8-6-7-14-19(16)22(33)28(21(14)32)15-9-10-17(29)27-20(15)31/h6-8,15H,4-5,9-13H2,1-3H3,(H,25,30)(H,26,34)(H,27,29,31) |
| InChIKey | UDUXJKKIIZAZLK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|