C34H34N6O8 — CID 154688444
tert-butyl N-[2-[4-[[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]phenyl]diazenyl]phenyl]ethyl]carbamate (PubChem CID 154688444) has the molecular formula C34H34N6O8 and a molecular weight of 654.68 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]phenyl]diazenyl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]phenyl]diazenyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 154688444 |
| Molecular Formula | C34H34N6O8 |
| Molecular Weight | 654.68 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | tert-butyl N-[2-[4-[[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]phenyl]diazenyl]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(/N=N/c2ccc(NC(=O)COc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)cc2)cc1 |
| InChI | InChI=1S/C34H34N6O8/c1-34(2,3)48-33(46)35-18-17-20-7-9-22(10-8-20)38-39-23-13-11-21(12-14-23)36-28(42)19-47-26-6-4-5-24-29(26)32(45)40(31(24)44)25-15-16-27(41)37-30(25)43/h4-14,25H,15-19H2,1-3H3,(H,35,46)(H,36,42)(H,37,41,43)/b39-38+ |
| InChIKey | GTXQOQOVSGYGDP-YMZYAJTMSA-N |
| XLogP | 4.59 |
| TPSA | 184.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|