C20H22N4O8 — CID 138611967
tert-butyl N-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]carbamate (PubChem CID 138611967) has the molecular formula C20H22N4O8 and a molecular weight of 446.42 g/mol. Its IUPAC name is tert-butyl N-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]carbamate.
| Compound Name | tert-butyl N-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]carbamate |
|---|---|
| PubChem CID | 138611967 |
| Molecular Formula | C20H22N4O8 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | tert-butyl N-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H22N4O8/c1-20(2,3)32-19(30)23-22-14(26)9-31-12-6-4-5-10-15(12)18(29)24(17(10)28)11-7-8-13(25)21-16(11)27/h4-6,11H,7-9H2,1-3H3,(H,22,26)(H,23,30)(H,21,25,27) |
| InChIKey | PZWTVYPSQVVTNZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|