C23H28N2O8 — CID 167164099
tert-butyl 2-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutoxy]acetate (PubChem CID 167164099) has the molecular formula C23H28N2O8 and a molecular weight of 460.48 g/mol. Its IUPAC name is tert-butyl 2-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutoxy]acetate.
| Compound Name | tert-butyl 2-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutoxy]acetate |
|---|---|
| PubChem CID | 167164099 |
| Molecular Formula | C23H28N2O8 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | tert-butyl 2-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H28N2O8/c1-23(2,3)33-18(27)13-31-11-4-5-12-32-16-8-6-7-14-19(16)22(30)25(21(14)29)15-9-10-17(26)24-20(15)28/h6-8,15H,4-5,9-13H2,1-3H3,(H,24,26,28) |
| InChIKey | IBECDEZKDIKLGE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|