C27H36N2O8 — CID 166007620
tert-butyl 3-[7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyheptoxy]propanoate (PubChem CID 166007620) has the molecular formula C27H36N2O8 and a molecular weight of 516.59 g/mol. Its IUPAC name is tert-butyl 3-[7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyheptoxy]propanoate.
| Compound Name | tert-butyl 3-[7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyheptoxy]propanoate |
|---|---|
| PubChem CID | 166007620 |
| Molecular Formula | C27H36N2O8 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | tert-butyl 3-[7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyheptoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCCCCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C27H36N2O8/c1-27(2,3)37-22(31)14-17-35-15-7-5-4-6-8-16-36-20-11-9-10-18-23(20)26(34)29(25(18)33)19-12-13-21(30)28-24(19)32/h9-11,19H,4-8,12-17H2,1-3H3,(H,28,30,32) |
| InChIKey | PCLLXNPQBFJYLI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|