C24H30N2O7 — CID 157246096
tert-butyl 4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]butanoate (PubChem CID 157246096) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is tert-butyl 4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]butanoate.
| Compound Name | tert-butyl 4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]butanoate |
|---|---|
| PubChem CID | 157246096 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | tert-butyl 4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCOCCCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H30N2O7/c1-24(2,3)33-19(28)10-6-14-32-13-5-8-15-7-4-9-16-20(15)23(31)26(22(16)30)17-11-12-18(27)25-21(17)29/h4,7,9,17H,5-6,8,10-14H2,1-3H3,(H,25,27,29) |
| InChIKey | AVUAGFQFHSNPCO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|