C25H33N3O7 — CID 146598924
tert-butyl N-[3-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]propyl]-N-methylcarbamate (PubChem CID 146598924) has the molecular formula C25H33N3O7 and a molecular weight of 487.55 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 146598924 |
| Molecular Formula | C25H33N3O7 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | tert-butyl N-[3-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]propyl]-N-methylcarbamate |
| SMILES | CN(CCCOCCCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H33N3O7/c1-25(2,3)35-24(33)27(4)13-7-15-34-14-6-9-16-8-5-10-17-20(16)23(32)28(22(17)31)18-11-12-19(29)26-21(18)30/h5,8,10,18H,6-7,9,11-15H2,1-4H3,(H,26,29,30) |
| InChIKey | PQTPORWRRBWEJG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|