C28H35N3O7 — CID 170979859
tert-butyl N-[9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxynon-5-ynyl]-N-methylcarbamate (PubChem CID 170979859) has the molecular formula C28H35N3O7 and a molecular weight of 525.60 g/mol. Its IUPAC name is tert-butyl N-[9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxynon-5-ynyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxynon-5-ynyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170979859 |
| Molecular Formula | C28H35N3O7 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | tert-butyl N-[9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxynon-5-ynyl]-N-methylcarbamate |
| SMILES | CN(CCCCC#CCCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H35N3O7/c1-28(2,3)38-27(36)30(4)17-10-8-6-5-7-9-11-18-37-21-14-12-13-19-23(21)26(35)31(25(19)34)20-15-16-22(32)29-24(20)33/h12-14,20H,6,8-11,15-18H2,1-4H3,(H,29,32,33) |
| InChIKey | LGPUBBHCLVJTJV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|