C24H27N3O7 — CID 138694184
tert-butyl N-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]prop-2-ynoxy]ethyl]-N-methylcarbamate (PubChem CID 138694184) has the molecular formula C24H27N3O7 and a molecular weight of 469.49 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]prop-2-ynoxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]prop-2-ynoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 138694184 |
| Molecular Formula | C24H27N3O7 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | tert-butyl N-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]prop-2-ynoxy]ethyl]-N-methylcarbamate |
| SMILES | CN(CCOCC#Cc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H27N3O7/c1-24(2,3)34-23(32)26(4)12-14-33-13-6-8-15-7-5-9-16-19(15)22(31)27(21(16)30)17-10-11-18(28)25-20(17)29/h5,7,9,17H,10-14H2,1-4H3,(H,25,28,29) |
| InChIKey | VJURQOHAUILUAK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|