C19H17N3O6 — CID 175144492
5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]pent-4-ynyl carbamate (PubChem CID 175144492) has the molecular formula C19H17N3O6 and a molecular weight of 383.36 g/mol. Its IUPAC name is 5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]pent-4-ynyl carbamate.
| Compound Name | 5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]pent-4-ynyl carbamate |
|---|---|
| PubChem CID | 175144492 |
| Molecular Formula | C19H17N3O6 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]pent-4-ynyl carbamate |
| SMILES | NC(=O)OCCCC#Cc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H17N3O6/c20-19(27)28-10-3-1-2-5-11-6-4-7-12-15(11)18(26)22(17(12)25)13-8-9-14(23)21-16(13)24/h4,6-7,13H,1,3,8-10H2,(H2,20,27)(H,21,23,24) |
| InChIKey | YUGWQXHFCGXMOF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|