C19H21N5O7 — CID 126615972
3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]carbamoyl-methylamino]propyl carbamate (PubChem CID 126615972) has the molecular formula C19H21N5O7 and a molecular weight of 431.41 g/mol. Its IUPAC name is 3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]carbamoyl-methylamino]propyl carbamate.
| Compound Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]carbamoyl-methylamino]propyl carbamate |
|---|---|
| PubChem CID | 126615972 |
| Molecular Formula | C19H21N5O7 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]carbamoyl-methylamino]propyl carbamate |
| SMILES | CN(CCCOC(N)=O)C(=O)Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H21N5O7/c1-23(8-3-9-31-18(20)29)19(30)21-11-5-2-4-10-14(11)17(28)24(16(10)27)12-6-7-13(25)22-15(12)26/h2,4-5,12H,3,6-9H2,1H3,(H2,20,29)(H,21,30)(H,22,25,26) |
| InChIKey | QZFVWMMFVLZGHU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 168.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|