C18H19N3O6 — CID 155292111
N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-5-hydroxypentanamide (PubChem CID 155292111) has the molecular formula C18H19N3O6 and a molecular weight of 373.37 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-5-hydroxypentanamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-5-hydroxypentanamide |
|---|---|
| PubChem CID | 155292111 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-5-hydroxypentanamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NC(=O)CCCCO)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H19N3O6/c22-9-2-1-6-13(23)19-11-5-3-4-10-15(11)18(27)21(17(10)26)12-7-8-14(24)20-16(12)25/h3-5,12,22H,1-2,6-9H2,(H,19,23)(H,20,24,25) |
| InChIKey | KQCMYJKZZQGWNJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|