C32H30N6O10 — CID 176669476
N'-[2-(5-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]hexanediamide (PubChem CID 176669476) has the molecular formula C32H30N6O10 and a molecular weight of 658.62 g/mol. Its IUPAC name is N'-[2-(5-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]hexanediamide.
| Compound Name | N'-[2-(5-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]hexanediamide |
|---|---|
| PubChem CID | 176669476 |
| Molecular Formula | C32H30N6O10 |
| Molecular Weight | 658.62 g/mol |
| Exact Mass | 658.20 |
| IUPAC Name | N'-[2-(5-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]hexanediamide |
| SMILES | NC(=O)CCC(C=O)N1C(=O)c2cccc(NC(=O)CCCCC(=O)Nc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)c2C1=O |
| InChI | InChI=1S/C32H30N6O10/c33-22(40)13-11-16(15-39)37-29(45)17-5-3-7-19(26(17)31(37)47)34-23(41)9-1-2-10-24(42)35-20-8-4-6-18-27(20)32(48)38(30(18)46)21-12-14-25(43)36-28(21)44/h3-8,15-16,21H,1-2,9-14H2,(H2,33,40)(H,34,41)(H,35,42)(H,36,43,44) |
| InChIKey | SEGSHRGLURCHKA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 239.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.62 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|