C36H34Cl2N6O13 — CID 162029231
4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-5-oxopentanoic acid;pentanedioyl dichloride (PubChem CID 162029231) has the molecular formula C36H34Cl2N6O13 and a molecular weight of 829.60 g/mol. Its IUPAC name is 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-5-oxopentanoic acid;pentanedioyl dichloride.
| Compound Name | 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-5-oxopentanoic acid;pentanedioyl dichloride |
|---|---|
| PubChem CID | 162029231 |
| Molecular Formula | C36H34Cl2N6O13 |
| Molecular Weight | 829.60 g/mol |
| Exact Mass | 828.16 |
| IUPAC Name | 4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-5-oxopentanoic acid;pentanedioyl dichloride |
| SMILES | Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.O=C(Cl)CCCC(=O)Cl.O=C(O)CCCC(=O)Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H17N3O7.C13H11N3O4.C5H6Cl2O2/c22-12(5-2-6-14(24)25)19-10-4-1-3-9-15(10)18(28)21(17(9)27)11-7-8-13(23)20-16(11)26;14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18;6-4(8)2-1-3-5(7)9/h1,3-4,11H,2,5-8H2,(H,19,22)(H,24,25)(H,20,23,26);1-3,8H,4-5,14H2,(H,15,17,18);1-3H2 |
| InChIKey | YVUJLPGZRPSFQF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 293.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.60 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|