C19H21N3O6 — CID 155292112
N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-6-hydroxyhexanamide (PubChem CID 155292112) has the molecular formula C19H21N3O6 and a molecular weight of 387.39 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-6-hydroxyhexanamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-6-hydroxyhexanamide |
|---|---|
| PubChem CID | 155292112 |
| Molecular Formula | C19H21N3O6 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-6-hydroxyhexanamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NC(=O)CCCCCO)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H21N3O6/c23-10-3-1-2-7-14(24)20-12-6-4-5-11-16(12)19(28)22(18(11)27)13-8-9-15(25)21-17(13)26/h4-6,13,23H,1-3,7-10H2,(H,20,24)(H,21,25,26) |
| InChIKey | QIDZQKVCLFJZEY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|