C26H34ClN3O10 — CID 155292409
3-[2-[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanamide (PubChem CID 155292409) has the molecular formula C26H34ClN3O10 and a molecular weight of 584.02 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanamide.
| Compound Name | 3-[2-[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanamide |
|---|---|
| PubChem CID | 155292409 |
| Molecular Formula | C26H34ClN3O10 |
| Molecular Weight | 584.02 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 3-[2-[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NC(=O)CCOCCOCCOCCOCCOCCCl)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H34ClN3O10/c27-7-9-37-11-13-39-15-17-40-16-14-38-12-10-36-8-6-22(32)28-19-3-1-2-18-23(19)26(35)30(25(18)34)20-4-5-21(31)29-24(20)33/h1-3,20H,4-17H2,(H,28,32)(H,29,31,33) |
| InChIKey | QWSJKBHVRKFRIG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.02 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|