C23H28ClN3O7 — CID 139465974
2-[4-(4-chlorobutoxy)butoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide (PubChem CID 139465974) has the molecular formula C23H28ClN3O7 and a molecular weight of 493.94 g/mol. Its IUPAC name is 2-[4-(4-chlorobutoxy)butoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide.
| Compound Name | 2-[4-(4-chlorobutoxy)butoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 139465974 |
| Molecular Formula | C23H28ClN3O7 |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-[4-(4-chlorobutoxy)butoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NC(=O)COCCCCOCCCCCl)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H28ClN3O7/c24-10-1-2-11-33-12-3-4-13-34-14-19(29)25-16-7-5-6-15-20(16)23(32)27(22(15)31)17-8-9-18(28)26-21(17)30/h5-7,17H,1-4,8-14H2,(H,25,29)(H,26,28,30) |
| InChIKey | AXGIDTLPQALZJO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|