C23H28N6O7 — CID 163335680
2-[2-(6-azidohexoxy)ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide (PubChem CID 163335680) has the molecular formula C23H28N6O7 and a molecular weight of 500.51 g/mol. Its IUPAC name is 2-[2-(6-azidohexoxy)ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide.
| Compound Name | 2-[2-(6-azidohexoxy)ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 163335680 |
| Molecular Formula | C23H28N6O7 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 2-[2-(6-azidohexoxy)ethoxy]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
| SMILES | [N-]=[N+]=NCCCCCCOCCOCC(=O)Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H28N6O7/c24-28-25-10-3-1-2-4-11-35-12-13-36-14-19(31)26-16-7-5-6-15-20(16)23(34)29(22(15)33)17-8-9-18(30)27-21(17)32/h5-7,17H,1-4,8-14H2,(H,26,31)(H,27,30,32) |
| InChIKey | UTTOXUMFMWDKPS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 179.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|