C26H31N7O9 — CID 156769887
N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N'-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-2-methylidenebutanediamide (PubChem CID 156769887) has the molecular formula C26H31N7O9 and a molecular weight of 585.57 g/mol. Its IUPAC name is N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N'-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-2-methylidenebutanediamide.
| Compound Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N'-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-2-methylidenebutanediamide |
|---|---|
| PubChem CID | 156769887 |
| Molecular Formula | C26H31N7O9 |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-N'-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-2-methylidenebutanediamide |
| SMILES | C=C(CC(=O)Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)NCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C26H31N7O9/c1-16(23(36)28-7-9-40-11-13-42-14-12-41-10-8-29-32-27)15-21(35)30-18-4-2-3-17-22(18)26(39)33(25(17)38)19-5-6-20(34)31-24(19)37/h2-4,19H,1,5-15H2,(H,28,36)(H,30,35)(H,31,34,37) |
| InChIKey | HPUNFYZVZBDPAS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 218.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|