C20H25N7O6 — CID 169161518
1-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]urea (PubChem CID 169161518) has the molecular formula C20H25N7O6 and a molecular weight of 459.46 g/mol. Its IUPAC name is 1-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]urea.
| Compound Name | 1-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]urea |
|---|---|
| PubChem CID | 169161518 |
| Molecular Formula | C20H25N7O6 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 1-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]urea |
| SMILES | [N-]=[N+]=NCCOCCOCCNC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H25N7O6/c21-26-23-7-9-33-11-10-32-8-6-22-20(31)24-15-3-1-2-13-14(15)12-27(19(13)30)16-4-5-17(28)25-18(16)29/h1-3,16H,4-12H2,(H2,22,24,31)(H,25,28,29) |
| InChIKey | HHRTVMQRJYFWJN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 174.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|