C25H37N3O11S — CID 153375812
2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanesulfonic acid (PubChem CID 153375812) has the molecular formula C25H37N3O11S and a molecular weight of 587.65 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanesulfonic acid.
| Compound Name | 2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 153375812 |
| Molecular Formula | C25H37N3O11S |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanesulfonic acid |
| SMILES | O=C1CCC(N2Cc3c(NCCOCCOCCOCCOCCOCCS(=O)(=O)O)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H37N3O11S/c29-23-5-4-22(24(30)27-23)28-18-20-19(25(28)31)2-1-3-21(20)26-6-7-35-8-9-36-10-11-37-12-13-38-14-15-39-16-17-40(32,33)34/h1-3,22,26H,4-18H2,(H,27,29,30)(H,32,33,34) |
| InChIKey | PHGDGYITRFHEER-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 179.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|