C22H29N3O4 — CID 170236568
2-(6-methylidene-2-oxopiperidin-3-yl)-4-[2-(4-methyl-3-oxopentoxy)ethylamino]-3H-isoindol-1-one (PubChem CID 170236568) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-(6-methylidene-2-oxopiperidin-3-yl)-4-[2-(4-methyl-3-oxopentoxy)ethylamino]-3H-isoindol-1-one.
| Compound Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-4-[2-(4-methyl-3-oxopentoxy)ethylamino]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 170236568 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-4-[2-(4-methyl-3-oxopentoxy)ethylamino]-3H-isoindol-1-one |
| SMILES | C=C1CCC(N2Cc3c(NCCOCCC(=O)C(C)C)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H29N3O4/c1-14(2)20(26)9-11-29-12-10-23-18-6-4-5-16-17(18)13-25(22(16)28)19-8-7-15(3)24-21(19)27/h4-6,14,19,23H,3,7-13H2,1-2H3,(H,24,27) |
| InChIKey | ZRWJAYHLHOVFKD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|